C26H24IN7O3S — CID 19576527
2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-nitrophenyl)methylideneamino]propanamide (PubChem CID 19576527) has the molecular formula C26H24IN7O3S and a molecular weight of 641.50 g/mol. Its IUPAC name is 2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-nitrophenyl)methylideneamino]propanamide.
| Compound Name | 2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 19576527 |
| Molecular Formula | C26H24IN7O3S |
| Molecular Weight | 641.50 g/mol |
| Exact Mass | 641.07 |
| IUPAC Name | 2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(E)-(4-nitrophenyl)methylideneamino]propanamide |
| SMILES | Cc1cc(I)ccc1NCc1nnc(SC(C)C(=O)N/N=C/c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24IN7O3S/c1-17-14-20(27)10-13-23(17)28-16-24-30-32-26(33(24)21-6-4-3-5-7-21)38-18(2)25(35)31-29-15-19-8-11-22(12-9-19)34(36)37/h3-15,18,28H,16H2,1-2H3,(H,31,35)/b29-15+ |
| InChIKey | UXGJTFGLLFCAEN-WKULSOCRSA-N |
| XLogP | 5.33 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|