C25H23IN6O2S — CID 6873847
N-[(E)-(3-hydroxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6873847) has the molecular formula C25H23IN6O2S and a molecular weight of 598.47 g/mol. Its IUPAC name is N-[(E)-(3-hydroxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(E)-(3-hydroxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6873847 |
| Molecular Formula | C25H23IN6O2S |
| Molecular Weight | 598.47 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | N-[(E)-(3-hydroxyphenyl)methylideneamino]-2-[[5-[(4-iodo-2-methylanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1cc(I)ccc1NCc1nnc(SCC(=O)N/N=C/c2cccc(O)c2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H23IN6O2S/c1-17-12-19(26)10-11-22(17)27-15-23-29-31-25(32(23)20-7-3-2-4-8-20)35-16-24(34)30-28-14-18-6-5-9-21(33)13-18/h2-14,27,33H,15-16H2,1H3,(H,30,34)/b28-14+ |
| InChIKey | UZPFWLLGDGDQOW-CCVNUDIWSA-N |
| XLogP | 4.74 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|