C34H28N6O2S — CID 6276055
2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide (PubChem CID 6276055) has the molecular formula C34H28N6O2S and a molecular weight of 584.71 g/mol. Its IUPAC name is 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6276055 |
| Molecular Formula | C34H28N6O2S |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CSc1nnc(CNc2cccc3ccccc23)n1-c1ccccc1)N/N=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C34H28N6O2S/c41-33(38-36-22-25-11-9-18-29(21-25)42-28-16-5-2-6-17-28)24-43-34-39-37-32(40(34)27-14-3-1-4-15-27)23-35-31-20-10-13-26-12-7-8-19-30(26)31/h1-22,35H,23-24H2,(H,38,41)/b36-22- |
| InChIKey | ULGQNPJATPEWCD-ICUTVXMZSA-N |
| XLogP | 7.07 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|