C28H29IN6OS — CID 124836838
(2R)-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylbutan-2-ylideneamino)propanamide (PubChem CID 124836838) has the molecular formula C28H29IN6OS and a molecular weight of 624.55 g/mol. Its IUPAC name is (2R)-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylbutan-2-ylideneamino)propanamide.
| Compound Name | (2R)-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylbutan-2-ylideneamino)propanamide |
|---|---|
| PubChem CID | 124836838 |
| Molecular Formula | C28H29IN6OS |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | (2R)-2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-phenylbutan-2-ylideneamino)propanamide |
| SMILES | CCC(Cc1ccccc1)=NNC(=O)[C@@H](C)Sc1nnc(CNc2ccc(I)cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C28H29IN6OS/c1-3-23(18-21-10-6-4-7-11-21)31-33-27(36)20(2)37-28-34-32-26(35(28)25-12-8-5-9-13-25)19-30-24-16-14-22(29)15-17-24/h4-17,20,30H,3,18-19H2,1-2H3,(H,33,36)/t20-/m1/s1 |
| InChIKey | NUXJEHLFAMMHMY-HXUWFJFHSA-N |
| XLogP | 6.09 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|