C30H28N6OS — CID 124836908
(2S)-2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)propanamide (PubChem CID 124836908) has the molecular formula C30H28N6OS and a molecular weight of 520.66 g/mol. Its IUPAC name is (2S)-2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)propanamide.
| Compound Name | (2S)-2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)propanamide |
|---|---|
| PubChem CID | 124836908 |
| Molecular Formula | C30H28N6OS |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | (2S)-2-[[5-(anilinomethyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-2-ylethylideneamino)propanamide |
| SMILES | CC(=NNC(=O)[C@H](C)Sc1nnc(CNc2ccccc2)n1-c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H28N6OS/c1-21(24-18-17-23-11-9-10-12-25(23)19-24)32-34-29(37)22(2)38-30-35-33-28(20-31-26-13-5-3-6-14-26)36(30)27-15-7-4-8-16-27/h3-19,22,31H,20H2,1-2H3,(H,34,37)/t22-/m0/s1 |
| InChIKey | QGYJANPAOFBLCK-QFIPXVFZSA-N |
| XLogP | 6.05 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|