C24H31N3O3 — CID 2420633
4-[[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]amino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 2420633) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-[[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]amino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 4-[[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]amino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 2420633 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-[[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]amino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(N[C@H](C)C(=O)NC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-30-22-15-13-21(14-16-22)27-24(29)18-9-11-20(12-10-18)25-17(2)23(28)26-19-7-5-4-6-8-19/h9-17,19,25H,3-8H2,1-2H3,(H,26,28)(H,27,29)/t17-/m1/s1 |
| InChIKey | AHGBLVWBUFKDMY-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |