C23H29N3O2S — CID 8614526
N-(4-ethoxyphenyl)-4-[[(1S,2S)-2-methylcyclohexyl]carbamothioylamino]benzamide (PubChem CID 8614526) has the molecular formula C23H29N3O2S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[[(1S,2S)-2-methylcyclohexyl]carbamothioylamino]benzamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[[(1S,2S)-2-methylcyclohexyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 8614526 |
| Molecular Formula | C23H29N3O2S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[[(1S,2S)-2-methylcyclohexyl]carbamothioylamino]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=S)N[C@H]3CCCC[C@@H]3C)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O2S/c1-3-28-20-14-12-18(13-15-20)24-22(27)17-8-10-19(11-9-17)25-23(29)26-21-7-5-4-6-16(21)2/h8-16,21H,3-7H2,1-2H3,(H,24,27)(H2,25,26,29)/t16-,21-/m0/s1 |
| InChIKey | NEGDGNOEMCFELZ-KKSFZXQISA-N |
| XLogP | 5.20 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|