C17H25N3S — CID 74766382
1-[(E)-(2-methylcyclohexylidene)amino]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 74766382) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 1-[(E)-(2-methylcyclohexylidene)amino]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-[(E)-(2-methylcyclohexylidene)amino]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 74766382 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 1-[(E)-(2-methylcyclohexylidene)amino]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC1CCCC/C1=N\NC(=S)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H25N3S/c1-12(2)14-8-10-15(11-9-14)18-17(21)20-19-16-7-5-4-6-13(16)3/h8-13H,4-7H2,1-3H3,(H2,18,20,21)/b19-16+ |
| InChIKey | YKNYKAVWSIIXCS-KNTRCKAVSA-N |
| XLogP | 4.66 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|