C20H27N3S — CID 18267005
1-(2-adamantylideneamino)-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 18267005) has the molecular formula C20H27N3S and a molecular weight of 341.52 g/mol. Its IUPAC name is 1-(2-adamantylideneamino)-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-(2-adamantylideneamino)-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 18267005 |
| Molecular Formula | C20H27N3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-(2-adamantylideneamino)-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)NN=C2C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C20H27N3S/c1-12(2)15-3-5-18(6-4-15)21-20(24)23-22-19-16-8-13-7-14(10-16)11-17(19)9-13/h3-6,12-14,16-17H,7-11H2,1-2H3,(H2,21,23,24)/b22-19- |
| InChIKey | ZZEGFURNOVJJRK-QOCHGBHMSA-N |
| XLogP | 4.91 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|