C18H25N3O2 — CID 6941303
N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-(4-methylphenyl)butanediamide (PubChem CID 6941303) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-(4-methylphenyl)butanediamide.
| Compound Name | N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-(4-methylphenyl)butanediamide |
|---|---|
| PubChem CID | 6941303 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | N'-[(Z)-[(2R)-2-methylcyclohexylidene]amino]-N-(4-methylphenyl)butanediamide |
| SMILES | Cc1ccc(NC(=O)CCC(=O)N/N=C2/CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-13-7-9-15(10-8-13)19-17(22)11-12-18(23)21-20-16-6-4-3-5-14(16)2/h7-10,14H,3-6,11-12H2,1-2H3,(H,19,22)(H,21,23)/b20-16-/t14-/m1/s1 |
| InChIKey | JUNGSZCLQZOFJL-XSOQZJFOSA-N |
| XLogP | 3.40 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|