About N-cyclopropyl-N'-phenylbutanediamide
N-cyclopropyl-N'-phenylbutanediamide (PubChem CID 70314355) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is N-cyclopropyl-N'-phenylbutanediamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N'-phenylbutanediamide |
| PubChem CID | 70314355 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-cyclopropyl-N'-phenylbutanediamide |
| SMILES | O=C(CCC(=O)NC1CC1)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N2O2/c16-12(14-10-4-2-1-3-5-10)8-9-13(17)15-11-6-7-11/h1-5,11H,6-9H2,(H,14,16)(H,15,17) |
| InChIKey | XFJJZYZASJSUQT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-N'-phenylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N'-phenylbutanediamide?
The IUPAC name of N-cyclopropyl-N'-phenylbutanediamide (CID 70314355) is N-cyclopropyl-N'-phenylbutanediamide.
What is the SMILES notation for N-cyclopropyl-N'-phenylbutanediamide?
The canonical SMILES for N-cyclopropyl-N'-phenylbutanediamide is O=C(CCC(=O)NC1CC1)Nc1ccccc1.
What is the InChIKey of N-cyclopropyl-N'-phenylbutanediamide?
The InChIKey is XFJJZYZASJSUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2/c16-12(14-10-4-2-1-3-5-10)8-9-13(17)15-11-6-7-11/h1-5,11H,6-9H2,(H,14,16)(H,15,17).
What are the key properties of N-cyclopropyl-N'-phenylbutanediamide?
N-cyclopropyl-N'-phenylbutanediamide has a molecular weight of 232.28 g/mol, XLogP of 1.68, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N'-phenylbutanediamide is sourced from PubChem (CID 70314355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).