C17H24N2O4 — CID 163312542
N'-(3-hydroxyphenyl)-N-(4-methoxycyclohexyl)butanediamide (PubChem CID 163312542) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N'-(3-hydroxyphenyl)-N-(4-methoxycyclohexyl)butanediamide.
| Compound Name | N'-(3-hydroxyphenyl)-N-(4-methoxycyclohexyl)butanediamide |
|---|---|
| PubChem CID | 163312542 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N'-(3-hydroxyphenyl)-N-(4-methoxycyclohexyl)butanediamide |
| SMILES | COC1CCC(NC(=O)CCC(=O)Nc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C17H24N2O4/c1-23-15-7-5-12(6-8-15)18-16(21)9-10-17(22)19-13-3-2-4-14(20)11-13/h2-4,11-12,15,20H,5-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | BQAZFDFQEJWHRO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |