C15H16O7 — CID 54686334
ethyl (E)-3-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate;hydrate (PubChem CID 54686334) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate;hydrate.
| Compound Name | ethyl (E)-3-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate;hydrate |
|---|---|
| PubChem CID | 54686334 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl (E)-3-hydroxy-2-(2-hydroxy-1,3-dioxoinden-2-yl)but-2-enoate;hydrate |
| SMILES | CCOC(=O)/C(=C(\C)O)C1(O)C(=O)c2ccccc2C1=O.O |
| InChI | InChI=1S/C15H14O6.H2O/c1-3-21-14(19)11(8(2)16)15(20)12(17)9-6-4-5-7-10(9)13(15)18;/h4-7,16,20H,3H2,1-2H3;1H2/b11-8-; |
| InChIKey | STDZZRMXKWKWMM-MKFZHGHUSA-N |
| XLogP | 0.37 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|