C28H20ClNO7 — CID 10118725
4'-[(4-acetylphenyl)carbamoyl]-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 10118725) has the molecular formula C28H20ClNO7 and a molecular weight of 517.92 g/mol. Its IUPAC name is 4'-[(4-acetylphenyl)carbamoyl]-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | 4'-[(4-acetylphenyl)carbamoyl]-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 10118725 |
| Molecular Formula | C28H20ClNO7 |
| Molecular Weight | 517.92 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 4'-[(4-acetylphenyl)carbamoyl]-5'-(4-chlorophenyl)-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | CC(=O)c1ccc(NC(=O)C2C(c3ccc(Cl)cc3)OC3(C(=O)c4ccccc4C3=O)C2C(=O)O)cc1 |
| InChI | InChI=1S/C28H20ClNO7/c1-14(31)15-8-12-18(13-9-15)30-26(34)21-22(27(35)36)28(37-23(21)16-6-10-17(29)11-7-16)24(32)19-4-2-3-5-20(19)25(28)33/h2-13,21-23H,1H3,(H,30,34)(H,35,36) |
| InChIKey | ORCBWOFMMQVLFV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|