C26H15Br2F2NO6 — CID 10189534
5'-(3,4-dibromophenyl)-4'-[(3,4-difluorophenyl)carbamoyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 10189534) has the molecular formula C26H15Br2F2NO6 and a molecular weight of 635.21 g/mol. Its IUPAC name is 5'-(3,4-dibromophenyl)-4'-[(3,4-difluorophenyl)carbamoyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | 5'-(3,4-dibromophenyl)-4'-[(3,4-difluorophenyl)carbamoyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 10189534 |
| Molecular Formula | C26H15Br2F2NO6 |
| Molecular Weight | 635.21 g/mol |
| Exact Mass | 632.92 |
| IUPAC Name | 5'-(3,4-dibromophenyl)-4'-[(3,4-difluorophenyl)carbamoyl]-1,3-dioxospiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C1C(c2ccc(Br)c(Br)c2)OC2(C(=O)c3ccccc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C26H15Br2F2NO6/c27-15-7-5-11(9-16(15)28)21-19(24(34)31-12-6-8-17(29)18(30)10-12)20(25(35)36)26(37-21)22(32)13-3-1-2-4-14(13)23(26)33/h1-10,19-21H,(H,31,34)(H,35,36) |
| InChIKey | PWNMQAALLCDGNQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|