C28H17Cl2N3O6S — CID 10282058
5'-(3,4-dichlorophenyl)-1,3-dioxo-4'-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid (PubChem CID 10282058) has the molecular formula C28H17Cl2N3O6S and a molecular weight of 594.43 g/mol. Its IUPAC name is 5'-(3,4-dichlorophenyl)-1,3-dioxo-4'-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid.
| Compound Name | 5'-(3,4-dichlorophenyl)-1,3-dioxo-4'-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid |
|---|---|
| PubChem CID | 10282058 |
| Molecular Formula | C28H17Cl2N3O6S |
| Molecular Weight | 594.43 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | 5'-(3,4-dichlorophenyl)-1,3-dioxo-4'-[[4-(thiadiazol-4-yl)phenyl]carbamoyl]spiro[indene-2,2'-oxolane]-3'-carboxylic acid |
| SMILES | O=C(Nc1ccc(-c2csnn2)cc1)C1C(c2ccc(Cl)c(Cl)c2)OC2(C(=O)c3ccccc3C2=O)C1C(=O)O |
| InChI | InChI=1S/C28H17Cl2N3O6S/c29-18-10-7-14(11-19(18)30)23-21(26(36)31-15-8-5-13(6-9-15)20-12-40-33-32-20)22(27(37)38)28(39-23)24(34)16-3-1-2-4-17(16)25(28)35/h1-12,21-23H,(H,31,36)(H,37,38) |
| InChIKey | GUMPEXCRYKLIOI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|