C23H22O7 — CID 23259703
dimethyl 1-benzyl-4,5-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 23259703) has the molecular formula C23H22O7 and a molecular weight of 410.42 g/mol. Its IUPAC name is dimethyl 1-benzyl-4,5-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-4,5-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 23259703 |
| Molecular Formula | C23H22O7 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | dimethyl 1-benzyl-4,5-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(Cc3ccccc3)OC1c1cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C23H22O7/c1-26-16-10-14-15(11-17(16)27-2)23(12-13-8-6-5-7-9-13)19(22(25)29-4)18(20(14)30-23)21(24)28-3/h5-11,20H,12H2,1-4H3 |
| InChIKey | WOTCLDXYSYYZET-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |