C18H18O9 — CID 12820172
tetramethyl 2-phenyl-2H-furan-3,4,5,5-tetracarboxylate (PubChem CID 12820172) has the molecular formula C18H18O9 and a molecular weight of 378.33 g/mol. Its IUPAC name is tetramethyl 2-phenyl-2H-furan-3,4,5,5-tetracarboxylate.
| Compound Name | tetramethyl 2-phenyl-2H-furan-3,4,5,5-tetracarboxylate |
|---|---|
| PubChem CID | 12820172 |
| Molecular Formula | C18H18O9 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | tetramethyl 2-phenyl-2H-furan-3,4,5,5-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(C(=O)OC)(C(=O)OC)OC1c1ccccc1 |
| InChI | InChI=1S/C18H18O9/c1-23-14(19)11-12(15(20)24-2)18(16(21)25-3,17(22)26-4)27-13(11)10-8-6-5-7-9-10/h5-9,13H,1-4H3 |
| InChIKey | XOZXAHPWMOGVDM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|