C15H14O5S — CID 10040793
dimethyl (1S,8S)-1-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 10040793) has the molecular formula C15H14O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is dimethyl (1S,8S)-1-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,8S)-1-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 10040793 |
| Molecular Formula | C15H14O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | dimethyl (1S,8S)-1-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(SC)O[C@H]1c1ccccc12 |
| InChI | InChI=1S/C15H14O5S/c1-18-13(16)10-11(14(17)19-2)15(21-3)9-7-5-4-6-8(9)12(10)20-15/h4-7,12H,1-3H3/t12-,15-/m0/s1 |
| InChIKey | HGAPTJZMMDJPTG-WFASDCNBSA-N |
| XLogP | 1.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |