C16H16O5S — CID 10426146
dimethyl (1S,8S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 10426146) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is dimethyl (1S,8S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,8S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 10426146 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | dimethyl (1S,8S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(SC)O[C@@]1(C)c1ccccc12 |
| InChI | InChI=1S/C16H16O5S/c1-15-9-7-5-6-8-10(9)16(21-15,22-4)12(14(18)20-3)11(15)13(17)19-2/h5-8H,1-4H3/t15-,16-/m0/s1 |
| InChIKey | YWIREFFQBJBUIY-HOTGVXAUSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |