C16H18O5S — CID 10403855
dimethyl (1R,8R,9R,10S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate (PubChem CID 10403855) has the molecular formula C16H18O5S and a molecular weight of 322.38 g/mol. Its IUPAC name is dimethyl (1R,8R,9R,10S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8R,9R,10S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 10403855 |
| Molecular Formula | C16H18O5S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | dimethyl (1R,8R,9R,10S)-1-methyl-8-methylsulfanyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@]2(SC)O[C@@]1(C)c1ccccc12 |
| InChI | InChI=1S/C16H18O5S/c1-15-9-7-5-6-8-10(9)16(21-15,22-4)12(14(18)20-3)11(15)13(17)19-2/h5-8,11-12H,1-4H3/t11-,12-,15+,16+/m1/s1 |
| InChIKey | CFQQJGIYFXWJBM-MPTQWLOMSA-N |
| XLogP | 2.04 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |