C26H32O6Si — CID 138973205
dimethyl (1R,8S,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate (PubChem CID 138973205) has the molecular formula C26H32O6Si and a molecular weight of 468.62 g/mol. Its IUPAC name is dimethyl (1R,8S,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1R,8S,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 138973205 |
| Molecular Formula | C26H32O6Si |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | dimethyl (1R,8S,9S,10S)-1-[tert-butyl(dimethyl)silyl]oxy-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-triene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@@]2(c3ccccc3)O[C@]1(O[Si](C)(C)C(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C26H32O6Si/c1-24(2,3)33(6,7)32-26-19-16-12-11-15-18(19)25(31-26,17-13-9-8-10-14-17)20(22(27)29-4)21(26)23(28)30-5/h8-16,20-21H,1-7H3/t20-,21-,25+,26+/m1/s1 |
| InChIKey | OBVMXJQBZFCFAC-VCPRHENPSA-N |
| XLogP | 4.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|