C23H28O2Si — CID 71551467
tert-butyl-dimethyl-[[(1R,8R)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methoxy]silane (PubChem CID 71551467) has the molecular formula C23H28O2Si and a molecular weight of 364.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,8R)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,8R)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 71551467 |
| Molecular Formula | C23H28O2Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,8R)-8-phenyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl]methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12C=C[C@](c3ccccc3)(O1)c1ccccc12 |
| InChI | InChI=1S/C23H28O2Si/c1-21(2,3)26(4,5)24-17-22-15-16-23(25-22,18-11-7-6-8-12-18)20-14-10-9-13-19(20)22/h6-16H,17H2,1-5H3/t22-,23+/m0/s1 |
| InChIKey | YKXNRJZHRHFBTP-XZOQPEGZSA-N |
| XLogP | 5.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|