C18H24Br2O2Si — CID 102194821
tert-butyl-[(4,5-dibromo-8-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)methoxy]-dimethylsilane (PubChem CID 102194821) has the molecular formula C18H24Br2O2Si and a molecular weight of 460.28 g/mol. Its IUPAC name is tert-butyl-[(4,5-dibromo-8-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4,5-dibromo-8-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102194821 |
| Molecular Formula | C18H24Br2O2Si |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | tert-butyl-[(4,5-dibromo-8-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraen-1-yl)methoxy]-dimethylsilane |
| SMILES | CC12C=CC(CO[Si](C)(C)C(C)(C)C)(O1)c1cc(Br)c(Br)cc12 |
| InChI | InChI=1S/C18H24Br2O2Si/c1-16(2,3)23(5,6)21-11-18-8-7-17(4,22-18)12-9-14(19)15(20)10-13(12)18/h7-10H,11H2,1-6H3 |
| InChIKey | MVRZEULOJLZLFJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|