C23H39BrOSi — CID 23518554
3-(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propoxy-tert-butyl-dimethylsilane (PubChem CID 23518554) has the molecular formula C23H39BrOSi and a molecular weight of 439.55 g/mol. Its IUPAC name is 3-(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23518554 |
| Molecular Formula | C23H39BrOSi |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 3-(3-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)propoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)CCC(C)(C)c2cc(CCCO[Si](C)(C)C(C)(C)C)c(Br)cc21 |
| InChI | InChI=1S/C23H39BrOSi/c1-21(2,3)26(8,9)25-14-10-11-17-15-18-19(16-20(17)24)23(6,7)13-12-22(18,4)5/h15-16H,10-14H2,1-9H3 |
| InChIKey | WDWHWYOZFIBXRW-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|