C18H32O3Si — CID 139256625
[(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-dien-2-yl]methanol (PubChem CID 139256625) has the molecular formula C18H32O3Si and a molecular weight of 324.54 g/mol. Its IUPAC name is [(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-dien-2-yl]methanol.
| Compound Name | [(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-dien-2-yl]methanol |
|---|---|
| PubChem CID | 139256625 |
| Molecular Formula | C18H32O3Si |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [(1R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-1-methyl-5-propan-2-yl-8-oxabicyclo[3.2.1]octa-2,6-dien-2-yl]methanol |
| SMILES | CC(C)[C@@]12C=C[C@@](C)(O1)C(CO)=C(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C18H32O3Si/c1-13(2)18-10-9-17(6,21-18)14(12-19)15(11-18)20-22(7,8)16(3,4)5/h9-10,13,19H,11-12H2,1-8H3/t17-,18+/m1/s1 |
| InChIKey | GVIVUFGXCWVXDU-MSOLQXFVSA-N |
| XLogP | 4.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|