C26H46O2Si — CID 10811991
[(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]inden-8-yl]methanol (PubChem CID 10811991) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]inden-8-yl]methanol.
| Compound Name | [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]inden-8-yl]methanol |
|---|---|
| PubChem CID | 10811991 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | [(3aR,5aR,6R,10aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,6,7,10,10a-octahydrocyclohepta[e]inden-8-yl]methanol |
| SMILES | CC(C)C1=C2[C@@H]3CC=C(CO)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C26H46O2Si/c1-18(2)20-12-13-25(6)14-15-26(7)21(23(20)25)11-10-19(17-27)16-22(26)28-29(8,9)24(3,4)5/h10,18,21-22,27H,11-17H2,1-9H3/t21-,22+,25+,26+/m0/s1 |
| InChIKey | YBIHDEHRYOEDSI-QTDJFWLRSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|