C24H40O2Si — CID 138980358
(3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydrocyclopenta[a]naphthalen-6-one (PubChem CID 138980358) has the molecular formula C24H40O2Si and a molecular weight of 388.67 g/mol. Its IUPAC name is (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydrocyclopenta[a]naphthalen-6-one.
| Compound Name | (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydrocyclopenta[a]naphthalen-6-one |
|---|---|
| PubChem CID | 138980358 |
| Molecular Formula | C24H40O2Si |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (3R,3aR,5aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a,5a-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydrocyclopenta[a]naphthalen-6-one |
| SMILES | CC(C)C1=C2C3=CCCC(=O)[C@]3(C)CC[C@@]2(C)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H40O2Si/c1-16(2)17-15-20(26-27(8,9)22(3,4)5)24(7)14-13-23(6)18(21(17)24)11-10-12-19(23)25/h11,16,20H,10,12-15H2,1-9H3/t20-,23-,24+/m1/s1 |
| InChIKey | QNZCPELAFTXXNT-HUVFLSCGSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|