C36H70O5Si3 — CID 117070426
(3S,4S,5S,8R)-4,5,14-tris[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-9-one (PubChem CID 117070426) has the molecular formula C36H70O5Si3 and a molecular weight of 667.21 g/mol. Its IUPAC name is (3S,4S,5S,8R)-4,5,14-tris[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-9-one.
| Compound Name | (3S,4S,5S,8R)-4,5,14-tris[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-9-one |
|---|---|
| PubChem CID | 117070426 |
| Molecular Formula | C36H70O5Si3 |
| Molecular Weight | 667.21 g/mol |
| Exact Mass | 666.45 |
| IUPAC Name | (3S,4S,5S,8R)-4,5,14-tris[[tert-butyl(dimethyl)silyl]oxy]-4-hydroxy-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-en-9-one |
| SMILES | CC1(C)C2CC=C(O[Si](C)(C)C(C)(C)C)C1C[C@@H]1[C@](O)(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]1(C)C(=O)C2 |
| InChI | InChI=1S/C36H70O5Si3/c1-31(2,3)42(13,14)39-27-20-19-25-23-29(37)35(12)22-21-30(40-43(15,16)32(4,5)6)36(38,41-44(17,18)33(7,8)9)28(35)24-26(27)34(25,10)11/h20,25-26,28,30,38H,19,21-24H2,1-18H3/t25?,26?,28-,30-,35+,36-/m0/s1 |
| InChIKey | BNLUXUFQRMQGTB-VBGOBCAJSA-N |
| XLogP | 10.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.21 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|