C31H56O7Si — CID 117070434
tert-butyl-dimethyl-[[(3R,5S,8R,9R,10R)-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-13-enyl]oxy]silane (PubChem CID 117070434) has the molecular formula C31H56O7Si and a molecular weight of 568.87 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3R,5S,8R,9R,10R)-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-13-enyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3R,5S,8R,9R,10R)-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-13-enyl]oxy]silane |
|---|---|
| PubChem CID | 117070434 |
| Molecular Formula | C31H56O7Si |
| Molecular Weight | 568.87 g/mol |
| Exact Mass | 568.38 |
| IUPAC Name | tert-butyl-dimethyl-[[(3R,5S,8R,9R,10R)-5,9,10-tris(methoxymethoxy)-8,15,15-trimethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-13-enyl]oxy]silane |
| SMILES | C=C1[C@@H](OCOC)CC[C@]2(C)[C@@H]1CC1C(O[Si](C)(C)C(C)(C)C)=CCC([C@@H](OCOC)[C@@H]2OCOC)C1(C)C |
| InChI | InChI=1S/C31H56O7Si/c1-21-23-17-24-26(38-39(11,12)29(2,3)4)14-13-22(30(24,5)6)27(36-19-33-9)28(37-20-34-10)31(23,7)16-15-25(21)35-18-32-8/h14,22-25,27-28H,1,13,15-20H2,2-12H3/t22?,23-,24?,25+,27-,28+,31-/m1/s1 |
| InChIKey | CXOMHXXLEJORNJ-OXLYSPDRSA-N |
| XLogP | 6.90 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.87 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|