C32H62O6Si2 — CID 14945839
(1S,3S,4S,5S,8R,9S,11R)-4,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-diol (PubChem CID 14945839) has the molecular formula C32H62O6Si2 and a molecular weight of 599.01 g/mol. Its IUPAC name is (1S,3S,4S,5S,8R,9S,11R)-4,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-diol.
| Compound Name | (1S,3S,4S,5S,8R,9S,11R)-4,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-diol |
|---|---|
| PubChem CID | 14945839 |
| Molecular Formula | C32H62O6Si2 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | (1S,3S,4S,5S,8R,9S,11R)-4,14-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)-8,15,15-trimethyltricyclo[9.3.1.03,8]pentadec-13-ene-4,9-diol |
| SMILES | COCO[C@H]1CC[C@@]2(C)[C@@H](O)C[C@H]3CC=C(O[Si](C)(C)C(C)(C)C)[C@@H](C[C@@H]2[C@]1(O)O[Si](C)(C)C(C)(C)C)C3(C)C |
| InChI | InChI=1S/C32H62O6Si2/c1-28(2,3)39(11,12)37-24-16-15-22-19-26(33)31(9)18-17-27(36-21-35-10)32(34,38-40(13,14)29(4,5)6)25(31)20-23(24)30(22,7)8/h16,22-23,25-27,33-34H,15,17-21H2,1-14H3/t22-,23-,25+,26+,27+,31-,32+/m1/s1 |
| InChIKey | VFAIHDFFWCNNFY-GYWFIKDSSA-N |
| XLogP | 7.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|