C19H36O4Si — CID 102482533
(1S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-ol (PubChem CID 102482533) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is (1S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-ol.
| Compound Name | (1S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-ol |
|---|---|
| PubChem CID | 102482533 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | (1S,5S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxymethyl)-7a-methyl-1,2,3,5,6,7-hexahydroinden-5-ol |
| SMILES | COCOCC1=C2CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C19H36O4Si/c1-18(2,3)24(6,7)23-17-9-8-15-14(12-22-13-21-5)16(20)10-11-19(15,17)4/h16-17,20H,8-13H2,1-7H3/t16-,17-,19-/m0/s1 |
| InChIKey | OMJDDBRUIJSGRE-LNLFQRSKSA-N |
| XLogP | 4.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|