C17H35BrO3Si — CID 102245911
[(1R)-2-bromo-3-(methoxymethoxymethyl)-4,4-dimethylcyclohexyl]oxy-tert-butyl-dimethylsilane (PubChem CID 102245911) has the molecular formula C17H35BrO3Si and a molecular weight of 395.45 g/mol. Its IUPAC name is [(1R)-2-bromo-3-(methoxymethoxymethyl)-4,4-dimethylcyclohexyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-2-bromo-3-(methoxymethoxymethyl)-4,4-dimethylcyclohexyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102245911 |
| Molecular Formula | C17H35BrO3Si |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(1R)-2-bromo-3-(methoxymethoxymethyl)-4,4-dimethylcyclohexyl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCOCC1C(Br)[C@H](O[Si](C)(C)C(C)(C)C)CCC1(C)C |
| InChI | InChI=1S/C17H35BrO3Si/c1-16(2,3)22(7,8)21-14-9-10-17(4,5)13(15(14)18)11-20-12-19-6/h13-15H,9-12H2,1-8H3/t13?,14-,15?/m1/s1 |
| InChIKey | JKDDKSDMSUXXQT-SHARSMKWSA-N |
| XLogP | 5.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|