C21H38O4Si — CID 117070200
tert-butyl-[[7-[4-(methoxymethoxy)but-1-en-2-yl]-5-methyl-8-oxatricyclo[3.3.1.02,7]nonan-1-yl]oxy]-dimethylsilane (PubChem CID 117070200) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is tert-butyl-[[7-[4-(methoxymethoxy)but-1-en-2-yl]-5-methyl-8-oxatricyclo[3.3.1.02,7]nonan-1-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[7-[4-(methoxymethoxy)but-1-en-2-yl]-5-methyl-8-oxatricyclo[3.3.1.02,7]nonan-1-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 117070200 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | tert-butyl-[[7-[4-(methoxymethoxy)but-1-en-2-yl]-5-methyl-8-oxatricyclo[3.3.1.02,7]nonan-1-yl]oxy]-dimethylsilane |
| SMILES | C=C(CCOCOC)C12CC3(C)CCC1C(O[Si](C)(C)C(C)(C)C)(C3)O2 |
| InChI | InChI=1S/C21H38O4Si/c1-16(10-12-23-15-22-6)20-13-19(5)11-9-17(20)21(14-19,24-20)25-26(7,8)18(2,3)4/h17H,1,9-15H2,2-8H3 |
| InChIKey | LYANQQLENKCWHP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|