C26H44O5Si — CID 62705783
methyl (1S,2S,4S,6R,7S,8R,11S,12S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8,12-trimethyl-5-oxapentacyclo[9.5.0.02,8.04,6.012,14]hexadecane-1-carboxylate (PubChem CID 62705783) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is methyl (1S,2S,4S,6R,7S,8R,11S,12S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8,12-trimethyl-5-oxapentacyclo[9.5.0.02,8.04,6.012,14]hexadecane-1-carboxylate.
| Compound Name | methyl (1S,2S,4S,6R,7S,8R,11S,12S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8,12-trimethyl-5-oxapentacyclo[9.5.0.02,8.04,6.012,14]hexadecane-1-carboxylate |
|---|---|
| PubChem CID | 62705783 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | methyl (1S,2S,4S,6R,7S,8R,11S,12S,14R)-14-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6,8,12-trimethyl-5-oxapentacyclo[9.5.0.02,8.04,6.012,14]hexadecane-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@]3(O[Si](C)(C)C(C)(C)C)C[C@@]3(C)[C@@H]1CC[C@@]1(C)[C@H](O)[C@@]3(C)O[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H44O5Si/c1-21(2,3)32(8,9)31-25-12-13-26(20(28)29-7)16(23(25,5)15-25)10-11-22(4)17(26)14-18-24(6,30-18)19(22)27/h16-19,27H,10-15H2,1-9H3/t16-,17-,18-,19-,22+,23-,24-,25+,26+/m0/s1 |
| InChIKey | FDZXLVWLKOIMKR-HRGBHAQNSA-N |
| XLogP | 5.06 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|