C20H33NO6Si — CID 13006253
methyl (1aS,2S,4R,4aR,5S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5,8-dihydroxy-8-methyl-2,3,4,5,6,7-hexahydro-1aH-naphtho[1,8a-b]oxirene-4a-carboxylate (PubChem CID 13006253) has the molecular formula C20H33NO6Si and a molecular weight of 411.57 g/mol. Its IUPAC name is methyl (1aS,2S,4R,4aR,5S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5,8-dihydroxy-8-methyl-2,3,4,5,6,7-hexahydro-1aH-naphtho[1,8a-b]oxirene-4a-carboxylate.
| Compound Name | methyl (1aS,2S,4R,4aR,5S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5,8-dihydroxy-8-methyl-2,3,4,5,6,7-hexahydro-1aH-naphtho[1,8a-b]oxirene-4a-carboxylate |
|---|---|
| PubChem CID | 13006253 |
| Molecular Formula | C20H33NO6Si |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | methyl (1aS,2S,4R,4aR,5S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-2-cyano-5,8-dihydroxy-8-methyl-2,3,4,5,6,7-hexahydro-1aH-naphtho[1,8a-b]oxirene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H](O)CC[C@](C)(O)[C@@]13O[C@H]3[C@H](C#N)C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NO6Si/c1-17(2,3)28(6,7)27-14-10-12(11-21)15-20(26-15)18(4,24)9-8-13(22)19(14,20)16(23)25-5/h12-15,22,24H,8-10H2,1-7H3/t12-,13-,14+,15-,18-,19-,20+/m0/s1 |
| InChIKey | QDJBBIYAFMWGJO-HNTHXWMSSA-N |
| XLogP | 2.12 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|