C19H34O4Si — CID 101264538
methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methylspiro[4.5]dec-9-ene-8-carboxylate (PubChem CID 101264538) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methylspiro[4.5]dec-9-ene-8-carboxylate.
| Compound Name | methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methylspiro[4.5]dec-9-ene-8-carboxylate |
|---|---|
| PubChem CID | 101264538 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (1R,4R,5R)-1-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methylspiro[4.5]dec-9-ene-8-carboxylate |
| SMILES | COC(=O)C1C=C[C@]2(CC1)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@]2(C)O |
| InChI | InChI=1S/C19H34O4Si/c1-17(2,3)24(6,7)23-15-10-11-18(4,21)19(15)12-8-14(9-13-19)16(20)22-5/h8,12,14-15,21H,9-11,13H2,1-7H3/t14?,15-,18-,19+/m1/s1 |
| InChIKey | NQEPYDKKCUULPX-LPDLYFKZSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|