C21H36O3Si — CID 11122068
trans-(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyphenyl)-2,2-dimethylcyclohexan-1-ol (PubChem CID 11122068) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is trans-(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyphenyl)-2,2-dimethylcyclohexan-1-ol.
| Compound Name | trans-(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyphenyl)-2,2-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11122068 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | trans-(1S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyphenyl)-2,2-dimethylcyclohexan-1-ol |
| SMILES | COc1ccccc1[C@]1(O)CCC[C@H](O[Si](C)(C)C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-19(2,3)25(7,8)24-18-14-11-15-21(22,20(18,4)5)16-12-9-10-13-17(16)23-6/h9-10,12-13,18,22H,11,14-15H2,1-8H3/t18-,21+/m0/s1 |
| InChIKey | VOZWVBRRKLAXMA-GHTZIAJQSA-N |
| XLogP | 5.48 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|