C14H20O3 — CID 106873696
2-methoxy-1-(2-methoxyphenyl)cyclohexan-1-ol (PubChem CID 106873696) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-methoxy-1-(2-methoxyphenyl)cyclohexan-1-ol.
| Compound Name | 2-methoxy-1-(2-methoxyphenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 106873696 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-methoxy-1-(2-methoxyphenyl)cyclohexan-1-ol |
| SMILES | COc1ccccc1C1(O)CCCCC1OC |
| InChI | InChI=1S/C14H20O3/c1-16-12-8-4-3-7-11(12)14(15)10-6-5-9-13(14)17-2/h3-4,7-8,13,15H,5-6,9-10H2,1-2H3 |
| InChIKey | ZEJSVMIQVFGSAJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |