C14H17F3O2 — CID 106873665
2-methoxy-1-[2-(trifluoromethyl)phenyl]cyclohexan-1-ol (PubChem CID 106873665) has the molecular formula C14H17F3O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-methoxy-1-[2-(trifluoromethyl)phenyl]cyclohexan-1-ol.
| Compound Name | 2-methoxy-1-[2-(trifluoromethyl)phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106873665 |
| Molecular Formula | C14H17F3O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-methoxy-1-[2-(trifluoromethyl)phenyl]cyclohexan-1-ol |
| SMILES | COC1CCCCC1(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H17F3O2/c1-19-12-8-4-5-9-13(12,18)10-6-2-3-7-11(10)14(15,16)17/h2-3,6-7,12,18H,4-5,8-9H2,1H3 |
| InChIKey | CWHRPYVELNGLAQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |