C24H46O5Si2 — CID 135016816
methyl (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carboxylate (PubChem CID 135016816) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is methyl (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 135016816 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl (4aR,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-4a-trimethylsilyloxy-2,3,4,6,7,8-hexahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1CC[C@@]2(O[Si](C)(C)C)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)C1=O |
| InChI | InChI=1S/C24H46O5Si2/c1-21(2,3)31(11,12)28-18-14-15-23(6)19(25)17(20(26)27-7)13-16-24(23,22(18,4)5)29-30(8,9)10/h17-18H,13-16H2,1-12H3/t17?,18-,23+,24+/m0/s1 |
| InChIKey | VFILYXRVWZNGKY-WRFXKRKGSA-N |
| XLogP | 5.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|