C18H32O5Si — CID 134835259
methyl (1R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8,8-dimethyl-5-oxobicyclo[5.1.0]octane-4-carboxylate (PubChem CID 134835259) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is methyl (1R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8,8-dimethyl-5-oxobicyclo[5.1.0]octane-4-carboxylate.
| Compound Name | methyl (1R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8,8-dimethyl-5-oxobicyclo[5.1.0]octane-4-carboxylate |
|---|---|
| PubChem CID | 134835259 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | methyl (1R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8,8-dimethyl-5-oxobicyclo[5.1.0]octane-4-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@H]2C(C)(C)[C@@]2(O[Si](C)(C)C(C)(C)C)CC1O |
| InChI | InChI=1S/C18H32O5Si/c1-16(2,3)24(7,8)23-18-10-12(20)14(15(21)22-6)11(19)9-13(18)17(18,4)5/h12-14,20H,9-10H2,1-8H3/t12?,13-,14?,18+/m0/s1 |
| InChIKey | DGKKOBDXPPUJFF-OGMSWHEOSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|