C22H40O7Si2 — CID 100978938
methyl (4R,5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 100978938) has the molecular formula C22H40O7Si2 and a molecular weight of 472.73 g/mol. Its IUPAC name is methyl (4R,5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (4R,5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 100978938 |
| Molecular Formula | C22H40O7Si2 |
| Molecular Weight | 472.73 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | methyl (4R,5R,6R,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5-hydroxy-3-oxo-4,5,6,7-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C2=C(COC2=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C22H40O7Si2/c1-21(2,3)30(8,9)28-17-13-12-27-20(25)14(13)15(19(24)26-7)16(23)18(17)29-31(10,11)22(4,5)6/h15-18,23H,12H2,1-11H3/t15-,16-,17+,18-/m1/s1 |
| InChIKey | AFVIYVVEDBUXHS-ZJPYXAASSA-N |
| XLogP | 3.78 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.73 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|