C22H43NO6Si2 — CID 11503798
(1R,2S,3S,4S,5R,6S)-7-acetyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxy-7-azabicyclo[4.2.1]nonan-8-one (PubChem CID 11503798) has the molecular formula C22H43NO6Si2 and a molecular weight of 473.76 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R,6S)-7-acetyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxy-7-azabicyclo[4.2.1]nonan-8-one.
| Compound Name | (1R,2S,3S,4S,5R,6S)-7-acetyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxy-7-azabicyclo[4.2.1]nonan-8-one |
|---|---|
| PubChem CID | 11503798 |
| Molecular Formula | C22H43NO6Si2 |
| Molecular Weight | 473.76 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | (1R,2S,3S,4S,5R,6S)-7-acetyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydroxy-7-azabicyclo[4.2.1]nonan-8-one |
| SMILES | CC(=O)N1C(=O)[C@@H]2C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H43NO6Si2/c1-13(24)23-15-12-14(20(23)27)18(28-30(8,9)21(2,3)4)16(25)17(26)19(15)29-31(10,11)22(5,6)7/h14-19,25-26H,12H2,1-11H3/t14-,15+,16+,17+,18+,19-/m1/s1 |
| InChIKey | KEETZYFSJBNCDY-YLXRRXKZSA-N |
| XLogP | 3.27 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|