C18H29NO4Si — CID 11337089
(1S,2S,3S,6R,8S)-4-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-11-oxa-4-azatricyclo[6.2.1.01,6]undec-9-en-5-one (PubChem CID 11337089) has the molecular formula C18H29NO4Si and a molecular weight of 351.52 g/mol. Its IUPAC name is (1S,2S,3S,6R,8S)-4-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-11-oxa-4-azatricyclo[6.2.1.01,6]undec-9-en-5-one.
| Compound Name | (1S,2S,3S,6R,8S)-4-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-11-oxa-4-azatricyclo[6.2.1.01,6]undec-9-en-5-one |
|---|---|
| PubChem CID | 11337089 |
| Molecular Formula | C18H29NO4Si |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (1S,2S,3S,6R,8S)-4-acetyl-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-11-oxa-4-azatricyclo[6.2.1.01,6]undec-9-en-5-one |
| SMILES | CC(=O)N1C(=O)[C@@H]2C[C@H]3C=C[C@@]2(O3)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C |
| InChI | InChI=1S/C18H29NO4Si/c1-11-15(23-24(6,7)17(3,4)5)18-9-8-13(22-18)10-14(18)16(21)19(11)12(2)20/h8-9,11,13-15H,10H2,1-7H3/t11-,13+,14-,15-,18-/m0/s1 |
| InChIKey | XHGLBDADMISTKL-GQCKSHLBSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|