C21H41F2NO4Si2 — CID 71505796
(1R,2R,7R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8-difluoro-8a-hydroxy-7-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one (PubChem CID 71505796) has the molecular formula C21H41F2NO4Si2 and a molecular weight of 465.73 g/mol. Its IUPAC name is (1R,2R,7R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8-difluoro-8a-hydroxy-7-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one.
| Compound Name | (1R,2R,7R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8-difluoro-8a-hydroxy-7-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 71505796 |
| Molecular Formula | C21H41F2NO4Si2 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | (1R,2R,7R,8aR)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-8,8-difluoro-8a-hydroxy-7-methyl-2,5,6,7-tetrahydro-1H-indolizin-3-one |
| SMILES | C[C@@H]1CCN2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]2(O)C1(F)F |
| InChI | InChI=1S/C21H41F2NO4Si2/c1-14-12-13-24-17(25)15(27-29(8,9)18(2,3)4)16(21(24,26)20(14,22)23)28-30(10,11)19(5,6)7/h14-16,26H,12-13H2,1-11H3/t14-,15-,16-,21-/m1/s1 |
| InChIKey | PKXRVPARARLKJM-WSOZGMELSA-N |
| XLogP | 4.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|