C28H58O6Si3 — CID 134866555
(4S,6S,7S,8R,9R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-3,6-dimethyl-5-oxaspiro[3.5]nonan-2-one (PubChem CID 134866555) has the molecular formula C28H58O6Si3 and a molecular weight of 575.02 g/mol. Its IUPAC name is (4S,6S,7S,8R,9R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-3,6-dimethyl-5-oxaspiro[3.5]nonan-2-one.
| Compound Name | (4S,6S,7S,8R,9R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-3,6-dimethyl-5-oxaspiro[3.5]nonan-2-one |
|---|---|
| PubChem CID | 134866555 |
| Molecular Formula | C28H58O6Si3 |
| Molecular Weight | 575.02 g/mol |
| Exact Mass | 574.35 |
| IUPAC Name | (4S,6S,7S,8R,9R)-7,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-3,6-dimethyl-5-oxaspiro[3.5]nonan-2-one |
| SMILES | C[C@@H]1O[C@@]2(CC(=O)C2(C)O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H58O6Si3/c1-19-21(32-35(12,13)24(2,3)4)22(33-36(14,15)25(5,6)7)23(34-37(16,17)26(8,9)10)28(31-19)18-20(29)27(28,11)30/h19,21-23,30H,18H2,1-17H3/t19-,21-,22+,23+,27?,28-/m0/s1 |
| InChIKey | CRAVPDZNSYHVBI-JQVHHNKDSA-N |
| XLogP | 7.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.02 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|