C16H26N2O5Si — CID 71566881
1-[(3S,5R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,4-dioxaspiro[2.4]heptan-5-yl]pyrimidine-2,4-dione (PubChem CID 71566881) has the molecular formula C16H26N2O5Si and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-[(3S,5R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,4-dioxaspiro[2.4]heptan-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3S,5R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,4-dioxaspiro[2.4]heptan-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71566881 |
| Molecular Formula | C16H26N2O5Si |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[(3S,5R,6S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,4-dioxaspiro[2.4]heptan-5-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@@]2(CO2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O5Si/c1-10-12(23-24(5,6)15(2,3)4)16(9-21-16)22-13(10)18-8-7-11(19)17-14(18)20/h7-8,10,12-13H,9H2,1-6H3,(H,17,19,20)/t10-,12-,13+,16-/m0/s1 |
| InChIKey | XEOYWWPQYBPPPE-VFFTVRQLSA-N |
| XLogP | 1.82 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|