C23H31ClN2O7Si — CID 135024551
[(2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-2-yl] 3-chlorobenzoate (PubChem CID 135024551) has the molecular formula C23H31ClN2O7Si and a molecular weight of 511.05 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-2-yl] 3-chlorobenzoate.
| Compound Name | [(2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-2-yl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 135024551 |
| Molecular Formula | C23H31ClN2O7Si |
| Molecular Weight | 511.05 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | [(2S,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)-4-methyloxolan-2-yl] 3-chlorobenzoate |
| SMILES | C[C@@H]1[C@H](n2ccc(=O)[nH]c2=O)O[C@@](CO)(OC(=O)c2cccc(Cl)c2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H31ClN2O7Si/c1-14-18(33-34(5,6)22(2,3)4)23(13-27,32-20(29)15-8-7-9-16(24)12-15)31-19(14)26-11-10-17(28)25-21(26)30/h7-12,14,18-19,27H,13H2,1-6H3,(H,25,28,30)/t14-,18-,19+,23-/m0/s1 |
| InChIKey | JMKVTWKHICJXFQ-JKXQAPCPSA-N |
| XLogP | 3.29 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.05 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|