C17H29ClN2O5Si — CID 159954430
1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 159954430) has the molecular formula C17H29ClN2O5Si and a molecular weight of 404.97 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159954430 |
| Molecular Formula | C17H29ClN2O5Si |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-chloro-5-(hydroxymethyl)-4-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@H]1[C@@H](Cl)[C@H](n2ccc(=O)[nH]c2=O)O[C@]1(CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29ClN2O5Si/c1-11-13(18)14(20-8-7-12(22)19-15(20)23)25-17(11,9-21)10-24-26(5,6)16(2,3)4/h7-8,11,13-14,21H,9-10H2,1-6H3,(H,19,22,23)/t11-,13+,14+,17+/m0/s1 |
| InChIKey | DYNPMKWLJBRXFW-ZCTGUTNYSA-N |
| XLogP | 2.06 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|